| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:08 UTC |
|---|
| Update Date | 2025-03-25 00:57:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226933 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H21N3O3 |
|---|
| Molecular Mass | 243.1583 |
|---|
| SMILES | CC(C)CC(N)C(=O)NN1CCCC1C(=O)O |
|---|
| InChI Key | GWTAODPRLSKBFD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | leucine and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acid hydrazidescarboxylic acidshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsproline and derivativespyrrolidine carboxylic acids |
|---|
| Substituents | proline or derivativescarboxylic acid hydrazidecarbonyl groupcarboxylic acidazacycleorganic oxidemonocarboxylic acid or derivativespyrrolidine carboxylic acid or derivativesorganic oxygen compoundleucine or derivativespyrrolidine carboxylic acidaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundpyrrolidineorganoheterocyclic compoundorganooxygen compound |
|---|