| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:09 UTC |
|---|
| Update Date | 2025-03-25 00:57:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226944 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10Cl6O2 |
|---|
| Molecular Mass | 347.8812 |
|---|
| SMILES | CC(C)CC(=O)OC(C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
|---|
| InChI Key | NVENZMNLTNJKBA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acid esters |
|---|
| Direct Parent | chloropropanol esters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl chloridescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochlorides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupalkyl chlorideorganochloridechloropropanol estercarboxylic acid derivativeorganohalogen compound1,3-dichloropropane-2-olorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esteralkyl halidehydrocarbon derivativeorganooxygen compound |
|---|