| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:14 UTC |
|---|
| Update Date | 2025-03-25 00:57:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02227113 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20O2 |
|---|
| Molecular Mass | 232.1463 |
|---|
| SMILES | CC(C)c1cccc(C2(C)CCOC(=O)C2)c1 |
|---|
| InChI Key | NQMBYKKBKNKLGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | cumenes |
|---|
| Direct Parent | cumenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersdelta valerolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanesphenylpropanes |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compounddelta valerolactonecarboxylic acid derivativelactonephenylpropaneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estercumenehydrocarbon derivativeoxanedelta_valerolactoneorganoheterocyclic compoundorganooxygen compound |
|---|