| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:15 UTC |
|---|
| Update Date | 2025-03-25 00:57:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02227165 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H44O3 |
|---|
| Molecular Mass | 404.329 |
|---|
| SMILES | CC(CCC(=O)O)C1CCC2C3CCC4C(C)(C)CCCC4(C)C3C(O)CC12C |
|---|
| InChI Key | MDKMZTPLQQTINX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | bile acids, alcohols and derivatives |
|---|
| Direct Parent | bile acids, alcohols and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 11-hydroxysteroidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidhydroxysteroidcyclic alcoholcarboxylic acid derivativebile acid, alcohol, or derivativesaliphatic homopolycyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivative11-hydroxysteroidorganooxygen compound |
|---|
