| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:15 UTC |
|---|
| Update Date | 2025-03-25 00:57:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02227172 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H45NO4 |
|---|
| Molecular Mass | 447.3349 |
|---|
| SMILES | CC(CCC(=O)NCC(=O)O)C1CCC2C3CCC4OC(C)(C)CCC4(C)C3CCC12C |
|---|
| InChI Key | XNMAIEVWMPFWSE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl aminesnaphthalenesnaphthopyransorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesoxasteroids and derivativespyranssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylcarbonyl groupethercarboxylic acidfatty amidedialkyl etheraliphatic heteropolycyclic compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxaneorganoheterocyclic compoundsteroidcarboxamide groupn-acyl-aminen-acylglycineoxacyclesecondary carboxylic acid amidenaphthopyranmonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundpyran4-oxasteroidhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
