| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:17 UTC |
|---|
| Update Date | 2025-03-25 00:57:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02227226 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C40H66O7 |
|---|
| Molecular Mass | 658.4809 |
|---|
| SMILES | CC(C)CCCC(C)C1CCC2C3=C(CCC21C)C1CCC2C(C)(C)C(OC4OC(C(=O)O)C(O)C(O)C4O)CCC2(C)C1(C)CC3 |
|---|
| InChI Key | HXTLEBLGTDFKTB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativeso-glucuronidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholssteroids and steroid derivativestriterpene glycosidestriterpenoids |
|---|
| Substituents | polycyclic triterpenoidcarbonyl groupcarboxylic acidglucuronic acid or derivativeso-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidtriterpene glycoside1-o-glucuronidealiphatic heteropolycyclic compoundtriterpenoidbeta-hydroxy acidorganic oxideacetaloxaneorganoheterocyclic compoundsteroidalcoholpyran carboxylic acid or derivativesterpene glycosidehydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivative |
|---|
