| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:21 UTC |
|---|
| Update Date | 2025-03-25 00:57:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02227383 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N7S |
|---|
| Molecular Mass | 249.0797 |
|---|
| SMILES | C=CCSc1nc2c(N)nc(N)nc2nc1N |
|---|
| InChI Key | BVIHNRSZEDRSIB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkylarylthioethersallyl sulfur compoundsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary aminespyrazinespyrimidines and pyrimidine derivativessulfenyl compounds |
|---|
| Substituents | sulfenyl compoundazacycleheteroaromatic compoundallyl sulfur compoundalkylarylthioetherorganosulfur compoundpteridinearyl thioetherpyrimidinearomatic heteropolycyclic compoundthioetherpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamine |
|---|
