| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:22 UTC |
|---|
| Update Date | 2025-03-25 00:57:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02227436 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18O3 |
|---|
| Molecular Mass | 210.1256 |
|---|
| SMILES | C=CC1C2CCC(O2)C1CCCC(=O)O |
|---|
| InChI Key | ZOTMKKUMGWPGAP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | heterocyclic fatty acids |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdialkyl ethersfatty acylshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsshort-chain hydroxy acids and derivativestetrahydrofurans |
|---|
| Substituents | carbonyl groupethercarboxylic acidshort-chain hydroxy acidtetrahydrofuranheterocyclic fatty acidcarboxylic acid derivativedialkyl etheraliphatic heteropolycyclic compoundoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
