| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:26 UTC |
|---|
| Update Date | 2025-03-25 00:57:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02227555 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11NO3 |
|---|
| Molecular Mass | 193.0739 |
|---|
| SMILES | CC(=O)N(C)C(=O)c1ccc(O)cc1 |
|---|
| InChI Key | KRHNCPFYBWMCMV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetamidesbenzoyl derivativescarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesn-substituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | carbonyl groupbenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativescarboxylic acid derivativecarboxylic acid imidearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativedicarboximideorganic nitrogen compoundcarboxylic acid imide, n-substitutedacetamideorganooxygen compound |
|---|
