| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:29 UTC |
|---|
| Update Date | 2025-03-25 00:57:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02227663 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H21Br2NO |
|---|
| Molecular Mass | 436.999 |
|---|
| SMILES | CC(=O)N(C)CCCC(c1ccc(Br)cc1)c1ccc(Br)cc1 |
|---|
| InChI Key | HRTHOMQXXMXHKU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesaryl bromidesbromobenzenescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganobromidesorganonitrogen compoundsorganopnictogen compoundsphenylbutylaminestertiary carboxylic acid amides |
|---|
| Substituents | diphenylmethanecarbonyl groupbromobenzenecarboxamide groupcarboxylic acid derivativeorganohalogen compoundaryl halidearomatic homomonocyclic compoundorganic oxidephenylbutylamineorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganobromideorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzenearyl bromideacetamideorganooxygen compound |
|---|
