| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:29 UTC |
|---|
| Update Date | 2025-03-25 00:57:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02227673 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H27N3O6 |
|---|
| Molecular Mass | 381.19 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(NC3OC(CO)C(O)C(O)C3O)cc2)CC1 |
|---|
| InChI Key | IKIQSMNGMIBKKZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylamineshydrocarbon derivativesmonosaccharidesn-arylpiperazinesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenylalkylaminesprimary alcoholssecondary alcoholssecondary alkylarylaminestertiary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesmonosaccharidecarboxylic acid derivativesaccharideorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundoxanedialkylarylamineprimary alcoholtertiary amineacetamidealcoholazacycleaniline or substituted anilinessecondary aminecarboxamide groupsecondary aliphatic/aromatic aminephenylpiperazineoxacycleorganic oxygen compoundsecondary alcoholphenylalkylaminehydrocarbon derivativebenzenoidorganic nitrogen compoundaminen-arylpiperazineorganooxygen compound |
|---|