| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:32 UTC |
|---|
| Update Date | 2025-03-25 00:57:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02227786 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12O6 |
|---|
| Molecular Mass | 264.0634 |
|---|
| SMILES | CC(=O)CC(=O)OC(=O)C=Cc1ccc(O)c(O)c1 |
|---|
| InChI Key | FNAOADWXLZXUMC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesbeta-keto acids and derivativescarboxylic acid anhydridesdicarboxylic acids and derivativeshydrocarbon derivativesketonesorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarbonyl group1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativebeta-keto acidhydroxycinnamic acidketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundketo acidcarboxylic acid anhydridedicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|