| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:43 UTC |
|---|
| Update Date | 2025-03-25 00:58:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02228190 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H26 |
|---|
| Molecular Mass | 266.2035 |
|---|
| SMILES | C=CC1=C(C)CC(C)(C)C1=Cc1c(C)ccc(C)c1C |
|---|
| InChI Key | QWPRWVAULLESAW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | aromatic monoterpenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativesbranched unsaturated hydrocarbonscycloalkenesmonocyclic monoterpenoidsunsaturated aliphatic hydrocarbons |
|---|
| Substituents | monocyclic benzene moietycyclic olefinmonocyclic monoterpenoidolefinhydrocarbonunsaturated hydrocarbonaromatic homomonocyclic compoundbranched unsaturated hydrocarboncycloalkeneunsaturated aliphatic hydrocarbonbenzenoidaromatic monoterpenoid |
|---|