| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:46 UTC |
|---|
| Update Date | 2025-03-25 00:58:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02228281 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H22NO+ |
|---|
| Molecular Mass | 184.1696 |
|---|
| SMILES | C=CC1(O)CCC([N+](C)(C)C)CC1 |
|---|
| InChI Key | MGLGVPOCJUOTDB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | aminescyclic alcohols and derivativescyclohexylamineshydrocarbon derivativesorganic cationsorganic saltsorganopnictogen compoundstertiary alcoholstetraalkylammonium salts |
|---|
| Substituents | tetraalkylammonium saltquaternary ammonium saltcyclohexanolcyclohexylaminecyclic alcoholtertiary alcoholorganonitrogen compoundaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamine |
|---|
