| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:58 UTC |
|---|
| Update Date | 2025-03-25 00:58:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02228706 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H17NO11P2 |
|---|
| Molecular Mass | 365.0277 |
|---|
| SMILES | CC(=O)NC1C(O)C(O)C(COP(=O)(O)OP(=O)(O)O)C1O |
|---|
| InChI Key | AHBKXJTYHVNRLD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organic oxoanionic compounds |
|---|
| Subclass | organic pyrophosphates |
|---|
| Direct Parent | organic pyrophosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acids and derivativescyclitols and derivativescyclopentanolshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | alcoholcarbonyl groupcyclitol or derivativescyclic alcoholcarboxamide groupcarboxylic acid derivativeorganic pyrophosphatecyclopentanolsecondary carboxylic acid amideorganic oxidephosphoric acid estermonoalkyl phosphateorganonitrogen compoundsecondary alcoholaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateacetamideorganooxygen compound |
|---|
