| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:58 UTC |
|---|
| Update Date | 2025-03-25 00:58:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02228709 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15NO5 |
|---|
| Molecular Mass | 229.095 |
|---|
| SMILES | CC(=O)NC1C(O)C(O)C(O)C2C=COC21 |
|---|
| InChI Key | JVXQAYUOKBIYFA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclitols and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acids and derivativesdihydrofuranshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcyclitol or derivativescarboxamide groupcarboxylic acid derivativealiphatic heteropolycyclic compoundoxacyclesecondary carboxylic acid amideorganic oxideorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundacetamidedihydrofuran |
|---|
