| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:58 UTC |
|---|
| Update Date | 2025-03-25 00:58:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02228734 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H27N3O6 |
|---|
| Molecular Mass | 321.19 |
|---|
| SMILES | CC(=O)NC1C(O)C(O)C(CO)OC1(O)CNCCCCN |
|---|
| InChI Key | VNDFMPIHDIODFP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativescarbonyl compoundscarboxylic acids and derivativesdialkylamineshemiacetalshydrocarbon derivativesmonoalkylaminesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupamino acid or derivativesmonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholsecondary aliphatic aminesecondary aminecarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundamine |
|---|