| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:03 UTC |
|---|
| Update Date | 2025-03-25 00:58:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02228896 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9NO7 |
|---|
| Molecular Mass | 231.0379 |
|---|
| SMILES | CC(=O)NC1C(=O)C(O)=C(O)OC1C(=O)O |
|---|
| InChI Key | JZUROEGYIONWIK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidescarboxylic acidscyclic ketonesdihydropyranoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amidesvinylogous acidsvinylogous esters |
|---|
| Substituents | carbonyl groupcarboxylic aciddihydropyranonecyclic ketonecarboxylic acid derivativeketoneorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundpyranoneorganopnictogen compoundacetamidepyran carboxylic acid or derivativesvinylogous estercarboxamide groupoxacyclesecondary carboxylic acid amidevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|