| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:11 UTC |
|---|
| Update Date | 2025-03-25 00:58:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02229192 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H26ClN3O |
|---|
| Molecular Mass | 323.1764 |
|---|
| SMILES | CCCCCCCCCC(=O)NC(=N)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | FHQXQRBCWSCGJY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | chlorobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundscarboximidamidescarboxylic acids and derivativesguanidineshydrocarbon derivativesiminesn-acyl aminesorganic oxidesorganochloridesorganopnictogen compounds |
|---|
| Substituents | aryl chloridechlorobenzenecarbonyl groupguanidineimineorganochloridecarboximidamidecarboxylic acid derivativeorganohalogen compoundn-acyl-aminearyl halidearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|