| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:15 UTC |
|---|
| Update Date | 2025-03-25 00:58:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02229323 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H39O9P |
|---|
| Molecular Mass | 466.2332 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)OC(COP(=O)(O)O)C(O)C(O)C=O |
|---|
| InChI Key | BJVUGOMHSWTAPR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acid estersfatty acid estershydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcohols |
|---|
| Substituents | fatty acylaliphatic acyclic compoundbeta-hydroxy aldehydecarbonyl grouppentose phosphatecarboxylic acid derivativeorganic oxidealpha-hydroxyaldehyde1,2-diolalcoholaldehydefatty acid estermonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatecarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|