| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:23 UTC |
|---|
| Update Date | 2025-03-25 00:58:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02229622 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H24O8 |
|---|
| Molecular Mass | 320.1471 |
|---|
| SMILES | CCCC=CCC(O)C(=O)OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | FDTLFJJEHLNRIT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl glycosides |
|---|
| Direct Parent | fatty acyl glycosides of mono- and disaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl glycosidescarbonyl compoundscarboxylic acid estersfatty acid estersfatty alcoholshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | fatty acyl glycoside of mono- or disaccharidecarbonyl groupmonosaccharidecarboxylic acid derivativesaccharideorganic oxideacetalfatty alcoholaliphatic heteromonocyclic compoundoxaneprimary alcoholorganoheterocyclic compoundalcoholoxacyclefatty acid estermonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compoundalkyl glycoside |
|---|
