| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:29 UTC |
|---|
| Update Date | 2025-03-25 00:58:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02229816 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20O2 |
|---|
| Molecular Mass | 232.1463 |
|---|
| SMILES | CCCC(CO)CC(C=O)=Cc1ccccc1 |
|---|
| InChI Key | VIGUEUXQAIGVIF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamaldehydes |
|---|
| Subclass | cinnamaldehydes |
|---|
| Direct Parent | cinnamaldehydes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aldehydesbenzene and substituted derivativesfatty alcoholshydrocarbon derivativesorganic oxidesprimary alcohols |
|---|
| Substituents | alcoholfatty acylmonocyclic benzene moietycinnamaldehydecarbonyl groupaldehydearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundfatty alcoholhydrocarbon derivativebenzenoidprimary alcoholorganooxygen compound |
|---|
