| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:34 UTC |
|---|
| Update Date | 2025-03-25 00:58:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230013 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H41NO8S |
|---|
| Molecular Mass | 527.2553 |
|---|
| SMILES | CCCCCC=CCC=CC=CC=CC(SCC(NC(CO)C(=O)O)C(=O)O)C(O)CCCC(=O)O |
|---|
| InChI Key | ILIIJEHAOCLDSN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | cysteine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkylaminesdialkylthioethershydrocarbon derivativesorganic oxidesorganopnictogen compoundsprimary alcoholssecondary alcoholsserine and derivativessulfenyl compoundstricarboxylic acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidamino acidtricarboxylic acid or derivativesorganosulfur compoundbeta-hydroxy acidorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcoholalcoholsecondary aliphatic aminesulfenyl compounddialkylthioetherhydroxy acidsecondary amineorganic oxygen compoundthioethercysteine or derivativessecondary alcoholhydrocarbon derivativeorganic nitrogen compoundserine or derivativesorganooxygen compoundamine |
|---|