| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:39 UTC |
|---|
| Update Date | 2025-03-25 00:58:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230194 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H27NO7 |
|---|
| Molecular Mass | 381.1788 |
|---|
| SMILES | CN(C)C1C(Oc2ccc(CC3CCC(=O)O3)cc2)OC(CO)C(O)C1O |
|---|
| InChI Key | AVRNMQLRXWNVEW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | aminoglycosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsacetalsalkyl glycosidesamino acids and derivativescarbonyl compoundscarboxylic acid estersfatty acyl glycosides of mono- and disaccharidesgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundsprimary alcoholssecondary alcoholstetrahydrofuranstrialkylamines |
|---|
| Substituents | fatty acyl glycoside of mono- or disaccharidephenol ethermonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesmonosaccharidecarboxylic acid derivativelactoneorganic oxideacetalorganonitrogen compoundaminoglycoside coreorganopnictogen compoundoxaneprimary alcoholtertiary amineorganoheterocyclic compoundalcohol1,2-aminoalcoholtetrahydrofurantertiary aliphatic aminegamma butyrolactoneoxacyclemonocarboxylic acid or derivativescarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundaminealkyl glycoside |
|---|
