| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:42 UTC |
|---|
| Update Date | 2025-03-25 00:58:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230291 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13ClN4O2S |
|---|
| Molecular Mass | 276.0448 |
|---|
| SMILES | CN(C)S(=O)(=O)NC(=N)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | VMKASSWHOUFQTF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | chlorobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridesguanidineshydrocarbon derivativesiminesorganic oxidesorganic sulfuric acids and derivativesorganochloridesorganopnictogen compounds |
|---|
| Substituents | aryl chloridechlorobenzeneorganic sulfuric acid or derivativesguanidineimineorganochlorideorganohalogen compoundaryl halidearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound |
|---|
