| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:42 UTC |
|---|
| Update Date | 2025-03-25 00:58:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230299 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12ClN3O4S2 |
|---|
| Molecular Mass | 312.9958 |
|---|
| SMILES | CN(C)c1cc(Cl)c(S(N)(=O)=O)cc1S(N)(=O)=O |
|---|
| InChI Key | VHYOSXHYMHIEEW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | aminobenzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundsaniline and substituted anilinesaryl chloridesbenzenesulfonyl compoundschlorobenzenesdialkylarylamineshydrocarbon derivativesorganic oxidesorganochloridesorganopnictogen compoundsorganosulfonamides |
|---|
| Substituents | organosulfonic acid or derivativesaminobenzenesulfonamideorganochlorideorganosulfur compoundorganohalogen compoundorganosulfonic acid amideorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary aminebenzenesulfonyl grouparyl chloridechlorobenzeneaminosulfonyl compoundaniline or substituted anilinesaryl halidearomatic homomonocyclic compoundsulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundhalobenzeneamine |
|---|
