| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:42 UTC |
|---|
| Update Date | 2025-03-25 00:58:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230304 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H27FN2O2 |
|---|
| Molecular Mass | 382.2057 |
|---|
| SMILES | CN(C)CCCC1(c2ccc(F)cc2)OCc2cc(C3CCC(=O)N3)ccc21 |
|---|
| InChI Key | PYJZTQWQXDPZPG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrrolidines |
|---|
| Subclass | phenylpyrrolidines |
|---|
| Direct Parent | phenylpyrrolidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaryl fluoridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkyl ethersfluorobenzeneshydrocarbon derivativesisocoumaranslactamsorganic oxidesorganofluoridesorganopnictogen compoundsoxacyclic compoundsphenylbutylaminespyrrolespyrrolidine-2-onessecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | aryl fluoride2-pyrrolidonemonocyclic benzene moietycarbonyl groupetherlactamamino acid or derivativescarboxylic acid derivativeorganohalogen compounddialkyl etherfluorobenzeneorganic oxidephenylbutylamineisocoumaranaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidonetertiary amineazacycleorganofluoride2-phenylpyrrolidinetertiary aliphatic aminecarboxamide grouparyl halideoxacyclesecondary carboxylic acid amideorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|