| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:43 UTC |
|---|
| Update Date | 2025-03-25 00:58:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230342 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16NO3PS |
|---|
| Molecular Mass | 285.0589 |
|---|
| SMILES | CCOP(=S)(OCC)Oc1ccc2[nH]ccc2c1 |
|---|
| InChI Key | FYLCGVNOMFRHRE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic thiophosphoric acids and derivatives |
|---|
| Subclass | thiophosphoric acid esters |
|---|
| Direct Parent | aryl thiophosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrrolesthiophosphate triesters |
|---|
| Substituents | azacyclearyl thiophosphateindoleheteroaromatic compoundindole or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidthiophosphate triesterorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
