| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:43 UTC |
|---|
| Update Date | 2025-03-25 00:58:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230357 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15N5O3S |
|---|
| Molecular Mass | 297.0896 |
|---|
| SMILES | CCSC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
|---|
| InChI Key | JVQHTPLREBZIGN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesmonothioacetalsn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary aminespyrimidines and pyrimidine derivativessecondary alcoholssulfenyl compoundstetrahydrofurans |
|---|
| Substituents | monosaccharideorganosulfur compoundpyrimidinemonothioacetalsaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamazole1,2-dioln-substituted imidazolealcoholsulfenyl compoundazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
