| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:44 UTC |
|---|
| Update Date | 2025-03-25 00:58:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230392 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12Cl3O5P |
|---|
| Molecular Mass | 299.9488 |
|---|
| SMILES | CCOP(=O)(OCC)OC(O)C(Cl)(Cl)Cl |
|---|
| InChI Key | HMLVTGCRQBZARH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | trialkyl phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl chlorideschlorohydrinshydrocarbon derivativesorganic oxidesorganochloridesorganooxygen compounds |
|---|
| Substituents | aliphatic acyclic compoundchlorohydrintrialkyl phosphatehalohydrinalkyl chlorideorganochlorideorganohalogen compoundorganic oxideorganic oxygen compoundalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
