| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:48 UTC |
|---|
| Update Date | 2025-03-25 00:58:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230543 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14N6O2 |
|---|
| Molecular Mass | 262.1178 |
|---|
| SMILES | CN1CCN(c2cnc3c(=O)[nH]c(=O)[nH]c3n2)CC1 |
|---|
| InChI Key | QCVMPSORVGHWPN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | n-arylpiperazines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aminopyrazinesazacyclic compoundsdialkylarylaminesheteroaromatic compoundshydrocarbon derivativesimidolactamslactamsn-methylpiperazinesorganic carbonic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundspteridines and derivativespyrimidonestrialkylaminesvinylogous amides |
|---|
| Substituents | lactampyrimidonepteridinepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddialkylarylamineimidolactamtertiary aminevinylogous amideaminopyrazinecarbonic acid derivativeazacyclen-alkylpiperazineheteroaromatic compoundtertiary aliphatic aminen-methylpiperazineorganic oxygen compoundpyrazinehydrocarbon derivativeorganic nitrogen compoundaminen-arylpiperazineorganooxygen compound |
|---|
