| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:49 UTC |
|---|
| Update Date | 2025-03-25 00:58:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230566 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16N2O2 |
|---|
| Molecular Mass | 220.1212 |
|---|
| SMILES | CNC(=O)c1ccc(N2CCOCC2)cc1 |
|---|
| InChI Key | KBNAYQMHFAGSOZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | oxazinanes |
|---|
| Subclass | morpholines |
|---|
| Direct Parent | phenylmorpholines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaminobenzamidesaniline and substituted anilinesazacyclic compoundsbenzamidesbenzoyl derivativescarboxylic acids and derivativesdialkyl ethersdialkylarylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietyetheraromatic heteromonocyclic compoundamino acid or derivativesbenzoylcarboxylic acid derivativedialkyl etherbenzamideorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylamineaminobenzoic acid or derivativestertiary aminephenylmorpholineazacycleaniline or substituted anilinesbenzoic acid or derivativescarboxamide groupaminobenzamideoxacyclesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
