| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:49 UTC |
|---|
| Update Date | 2025-03-25 00:58:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230590 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N4O2S |
|---|
| Molecular Mass | 256.0994 |
|---|
| SMILES | CNC(=N)NCCSCc1ccc(C(N)=O)o1 |
|---|
| InChI Key | CXAHAOSBHRIVCG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furans |
|---|
| Subclass | furoic acid and derivatives |
|---|
| Direct Parent | furoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidescarboximidamidescarboxylic acids and derivativesdialkylthioethersguanidinesheteroaromatic compoundshydrocarbon derivativesiminesorganic oxidesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsprimary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | primary carboxylic acid amidearomatic heteromonocyclic compoundguanidineimineorganosulfur compoundcarboxylic acid derivative2-heteroaryl carboxamideorganic oxideorganonitrogen compoundorganopnictogen compoundfuroic acid or derivativessulfenyl compounddialkylthioetherheteroaromatic compoundcarboximidamidecarboxamide groupoxacycleorganic oxygen compoundthioetherhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|