| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:51 UTC |
|---|
| Update Date | 2025-03-25 00:58:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230640 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8N2O5S |
|---|
| Molecular Mass | 244.0154 |
|---|
| SMILES | CN(N=O)S(=O)(=O)c1ccc(C(=O)O)cc1 |
|---|
| InChI Key | WESOSQLIFNGLNC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzenesulfonyl compoundsbenzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic n-nitroso compoundsorganic oxidesorganooxygen compoundsorganopnictogen compoundssulfonohydrazidessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativescarboxylic acidsulfonohydrazidebenzoylorganosulfur compoundcarboxylic acid derivativeorganic n-nitroso compoundorganic oxideorganonitrogen compoundorganopnictogen compoundbenzoic acidbenzenesulfonyl grouporganic nitroso compoundbenzenesulfonamidebenzoic acid or derivativesaromatic homomonocyclic compoundmonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
