| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:12:53 UTC |
|---|
| Update Date | 2025-03-25 00:58:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02230732 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H23NO8 |
|---|
| Molecular Mass | 369.1424 |
|---|
| SMILES | CN1CCC23COC4C(OC5C=CC2C1C5O3)OC(C(=O)O)C(O)C4O |
|---|
| InChI Key | NBHQUZYJSRQIBJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1,4-oxazepinesacetalsamino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespiperidinespyran carboxylic acidssecondary alcoholstetrahydrofuranstrialkylamines |
|---|
| Substituents | carbonyl groupethercarboxylic acidglucuronic acid or derivativesamino acid or derivativesamino acidmonosaccharidecarboxylic acid derivativepyran carboxylic aciddialkyl etheraliphatic heteropolycyclic compoundbeta-hydroxy acidorganic oxideacetalorganonitrogen compoundorganopnictogen compoundoxanepiperidinetertiary amineorganoheterocyclic compound1,2-diolalcoholpyran carboxylic acid or derivativesazacycletetrahydrofurantertiary aliphatic aminehydroxy acidpara-oxazepineoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamine |
|---|
