| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:01 UTC |
|---|
| Update Date | 2025-03-25 00:58:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231027 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C25H34N2O4 |
|---|
| Molecular Mass | 426.2519 |
|---|
| SMILES | CCN(CC(O)C(Cc1ccccc1)NC(=O)OC1CCOC1)c1c(C)cccc1C |
|---|
| InChI Key | LPMDYEHDPREJJD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylbutylamines |
|---|
| Direct Parent | phenylbutylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsamphetamines and derivativesaniline and substituted anilinescarbamate esterscarbonyl compoundsdialkyl ethersdialkylarylamineshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetrahydrofuransm-xylenes |
|---|
| Substituents | carbonyl groupetheraromatic heteromonocyclic compounddialkyl etherxyleneorganic oxidephenylbutylaminetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineorganoheterocyclic compoundamphetamine or derivativesalcoholcarbonic acid derivative1,2-aminoalcoholtetrahydrofurananiline or substituted anilinesm-xylenecarbamic acid esteroxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
