| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:01 UTC |
|---|
| Update Date | 2025-03-25 00:58:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231046 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H23NO4 |
|---|
| Molecular Mass | 293.1627 |
|---|
| SMILES | CCN(CC)CCOC(=O)CC(=O)c1ccc(OC)cc1 |
|---|
| InChI Key | NDHFMJAXVRQLGT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersamino acids and derivativesanisolesaryl alkyl ketonesbenzoyl derivativesbeta-keto acids and derivativescarboxylic acid estersfatty acid estershydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsphenoxy compoundstrialkylamines |
|---|
| Substituents | fatty acylphenol ethermonocyclic benzene moietyetheraryl alkyl ketoneamino acid or derivativesbenzoylalkyl aryl ethercarboxylic acid derivativebeta-keto acidorganic oxideorganonitrogen compoundorganopnictogen compoundtertiary aminetertiary aliphatic aminemethoxybenzenearomatic homomonocyclic compoundfatty acid estermonocarboxylic acid or derivativesanisoleketo acidcarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundaminealkyl-phenylketone |
|---|
