| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:01 UTC |
|---|
| Update Date | 2025-03-25 00:58:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231051 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H23NO5 |
|---|
| Molecular Mass | 345.1576 |
|---|
| SMILES | CCN(CC)CCOc1ccc(C(=O)c2c(O)cc(O)cc2O)cc1 |
|---|
| InChI Key | LQCGILCHQXWJIP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersaryl ketonesaryl-phenylketonesbenzoyl derivativesdiphenylmethaneshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundsphloroglucinols and derivativestrialkylaminesvinylogous acids |
|---|
| Substituents | diphenylmethanephenol etheretherbenzoyl1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherbenzophenoneketonephloroglucinol derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundtertiary aminebenzenetriolaryl-phenylketonetertiary aliphatic amine1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundvinylogous acidorganic oxygen compoundphenolhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compoundaryl ketone |
|---|
