| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:02 UTC |
|---|
| Update Date | 2025-03-25 00:58:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231066 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H20N2O2 |
|---|
| Molecular Mass | 272.1525 |
|---|
| SMILES | CCOC(=O)N1CCC(=C2NCc3ccccc32)CC1 |
|---|
| InChI Key | MRKRCEJPXJZJJW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | isoindoles and derivatives |
|---|
| Subclass | isoindoles |
|---|
| Direct Parent | isoindoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidscarbamate esterscarbonyl compoundsdialkylamineshydrocarbon derivativesisoindolinesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundspiperidinecarboxylic acidspiperidines |
|---|
| Substituents | secondary aliphatic aminecarbonyl groupcarbonic acid derivativeazacycleisoindolecarbamic acid estersecondary amineorganic oxideorganic oxygen compoundisoindolinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativepiperidinecarboxylic acidbenzenoidorganic nitrogen compoundpiperidineorganooxygen compoundamine |
|---|