| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:03 UTC |
|---|
| Update Date | 2025-03-25 00:58:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231113 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H22O11 |
|---|
| Molecular Mass | 390.1162 |
|---|
| SMILES | CCOC(=O)C1OC(C(=O)OC)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
|---|
| InChI Key | RMDYWGHUHSYAJR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | pentacarboxylic acids and derivatives |
|---|
| Direct Parent | pentacarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundsdialkyl ethersglucuronic acid derivativeshydrocarbon derivativesmethyl estersmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acids |
|---|
| Substituents | carbonyl groupetherpyran carboxylic acid or derivativesglucuronic acid or derivativesmonosaccharidepyran carboxylic acidpentacarboxylic acid or derivativesdialkyl etheroxacyclesaccharideorganic oxidemethyl esterorganic oxygen compoundpyrancarboxylic acid esteraliphatic heteromonocyclic compoundhydrocarbon derivativeoxaneorganoheterocyclic compoundorganooxygen compound |
|---|
