| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:04 UTC |
|---|
| Update Date | 2025-03-25 00:58:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231160 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19NO2 |
|---|
| Molecular Mass | 269.1416 |
|---|
| SMILES | CCCN(Cc1ccccc1)c1ccc(C(=O)O)cc1 |
|---|
| InChI Key | RQFHIAQSKLBGIN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylmethylamines |
|---|
| Direct Parent | phenylbenzamines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acidsaminobenzoic acids and derivativesaniline and substituted anilinesaralkylaminesbenzoic acidsbenzoyl derivativesbenzylaminescarboxylic acidsdialkylarylamineshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compounds |
|---|
| Substituents | carboxylic acidamino acid or derivativesamino acidbenzoylcarboxylic acid derivativearalkylamineorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compoundbenzoic aciddialkylarylamineaminobenzoic acid or derivativestertiary amineaniline or substituted anilinesbenzoic acid or derivativesaromatic homomonocyclic compoundphenylbenzaminemonocarboxylic acid or derivativesorganic oxygen compoundbenzylaminehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
