| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:09 UTC |
|---|
| Update Date | 2025-03-25 00:58:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231339 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19NO |
|---|
| Molecular Mass | 217.1467 |
|---|
| SMILES | CC1CCC(C)(C)c2ccc(C(N)=O)cc21 |
|---|
| InChI Key | VGFHACXDVKXFND-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenecarboxylic acids and derivatives |
|---|
| Direct Parent | naphthalenecarboxylic acids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | carboxylic acids and derivativeshydrocarbon derivativesnaphthalenecarboxamidesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsprimary carboxylic acid amidestetralins |
|---|
| Substituents | primary carboxylic acid amidetetralinaromatic homopolycyclic compoundcarboxamide groupcarboxylic acid derivative2-naphthalenecarboxamideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound2-naphthalenecarboxylic acidorganooxygen compound |
|---|
