| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:10 UTC |
|---|
| Update Date | 2025-03-25 00:58:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231381 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H6O7S |
|---|
| Molecular Mass | 209.9834 |
|---|
| SMILES | CC1C(=O)OC(=O)C1OS(=O)(=O)O |
|---|
| InChI Key | KKYVBEDFYQRHCJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatescarbonyl compoundscarboxylic acid anhydridesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | sulfuric acid monoestercarbonyl grouptetrahydrofurancarboxylic acid derivativeoxacycleorganic oxideorganic oxygen compoundalkyl sulfatealiphatic heteromonocyclic compoundcarboxylic acid anhydridedicarboxylic acid or derivativessulfate-esterhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
