| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:11 UTC |
|---|
| Update Date | 2025-03-25 00:58:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231423 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20O4 |
|---|
| Molecular Mass | 336.1362 |
|---|
| SMILES | CC1C(Oc2ccc3c(ccc4ccccc43)c2)OC(C(=O)O)C1C |
|---|
| InChI Key | SEXBUEQLJPWPPB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthalenesorganic oxidesoxacyclic compoundsphenol etherstetrahydrofurans |
|---|
| Substituents | phenol etherphenanthrenecarbonyl groupcarboxylic acidtetrahydrofurancarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundacetalaromatic heteropolycyclic compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
