| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:12 UTC |
|---|
| Update Date | 2025-03-25 00:58:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231434 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C29H36O6 |
|---|
| Molecular Mass | 480.2512 |
|---|
| SMILES | CC1C=C2C=CC(C)C(CCC3CC(O)CC(=O)O3)C2CC(OC(=O)C=Cc2ccc(O)cc2)C1 |
|---|
| InChI Key | YVJVMFZXHLCGAB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundsdelta valerolactonesdicarboxylic acids and derivativesenoate estersfatty acid estershydrocarbon derivativesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupdelta valerolactone1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativelactonealpha,beta-unsaturated carboxylic esterorganic oxidearomatic heteropolycyclic compoundoxanedelta_valerolactoneorganoheterocyclic compoundenoate esteralcoholhydroxycinnamic acidoxacyclefatty acid esterorganic oxygen compoundcarboxylic acid estersecondary alcoholdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
