| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:12 UTC |
|---|
| Update Date | 2025-03-25 00:58:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231458 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H28O14 |
|---|
| Molecular Mass | 528.1479 |
|---|
| SMILES | CC1OC(OCC2OC(Oc3cc(=O)occ3-c3ccc(O)c(O)c3)C(O)C(O)C2O)C(O)C(O)C1O |
|---|
| InChI Key | VEPHSLRUXINFFE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | pyranones and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeslactonesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholsvinylogous esters |
|---|
| Substituents | alcoholmonocyclic benzene moietyaromatic heteromonocyclic compoundvinylogous esterheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidmonosaccharide1-hydroxy-4-unsubstituted benzenoidlactoneoxacyclesaccharideorganic oxideorganic oxygen compoundacetalpyranonesecondary alcoholphenolhydrocarbon derivativebenzenoidoxaneorganooxygen compound |
|---|
