| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:19 UTC |
|---|
| Update Date | 2025-03-25 00:58:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231739 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H30O5 |
|---|
| Molecular Mass | 350.2093 |
|---|
| SMILES | CC12CCC(O)CC1CC(=O)C1C2CCC2(C)C1CCC2(O)C(=O)O |
|---|
| InChI Key | CWCURPCVZPEYMC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | androstane steroids |
|---|
| Direct Parent | androgens and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 17-hydroxysteroids3-hydroxysteroids7-oxosteroidsalpha hydroxy acids and derivativescarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesketonesmonocarboxylic acids and derivativesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | 20-hydroxysteroidcarbonyl groupcarboxylic acidandrogen-skeletonalpha-hydroxy acidcarboxylic acid derivativealiphatic homopolycyclic compoundketoneorganic oxide17-hydroxysteroidalcoholoxosteroid3-hydroxysteroidhydroxysteroidhydroxy acidcyclic alcoholtertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivative7-oxosteroidorganooxygen compound |
|---|
