| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:20 UTC |
|---|
| Update Date | 2025-03-25 00:58:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231749 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12O3S |
|---|
| Molecular Mass | 212.0507 |
|---|
| SMILES | CC1(c2ccccc2)CS(=O)(=O)CO1 |
|---|
| InChI Key | AZJXARVSPUDQLG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesmonothioacetalsorganic oxidesorganooxygen compoundsoxacyclic compoundsoxathiolanessulfones |
|---|
| Substituents | monocyclic benzene moietyoxathiolanearomatic heteromonocyclic compoundmonothioacetaloxacycleorganic oxideorganic oxygen compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compoundsulfone |
|---|
