| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:20 UTC |
|---|
| Update Date | 2025-03-25 00:58:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231769 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H34O10 |
|---|
| Molecular Mass | 470.2152 |
|---|
| SMILES | CC12CC(O)C3C(CCC4CC(OC5OC(C(=O)O)C(O)C(O)C5O)OC43C)C1CCC2=O |
|---|
| InChI Key | KZHKHOSFCZUHEH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsbeta hydroxy acids and derivativescarboxylic acidscyclic alcohols and derivativesglucuronic acid derivativeshydrocarbon derivativesketonesmonocarboxylic acids and derivativesmonosaccharidesnaphthofuransorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupcarboxylic acido-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidketone1-o-glucuronidealiphatic heteropolycyclic compoundbeta-hydroxy acidorganic oxideacetaloxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesnaphthofurantetrahydrofuranhydroxy acidcyclic alcoholoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivative |
|---|