| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:13:21 UTC |
|---|
| Update Date | 2025-03-25 00:58:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02231781 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C25H36O5 |
|---|
| Molecular Mass | 416.2563 |
|---|
| SMILES | CC12CCc3cc(O)ccc3C1CCC1C2C(O)CC2(C)C1CCC2(O)C(O)CO |
|---|
| InChI Key | ARHXGKMBPKOVSX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | hydroxysteroids |
|---|
| Direct Parent | 21-hydroxysteroids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids11-hydroxysteroids17-hydroxysteroidscyclic alcohols and derivativeshydrocarbon derivativesphenanthrenes and derivativespregnane steroidsprimary alcoholssecondary alcoholstertiary alcoholstetralins |
|---|
| Substituents | alcoholtetralinphenanthrene1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundcyclic alcoholtertiary alcoholorganic oxygen compound21-hydroxysteroidsecondary alcoholhydrocarbon derivative11-hydroxysteroidbenzenoidprimary alcoholpregnane-skeletonorganooxygen compound17-hydroxysteroid |
|---|
